EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O3 |
| Net Charge | 0 |
| Average Mass | 212.204 |
| Monoisotopic Mass | 212.04734 |
| SMILES | O=C1Oc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C13H8O3/c14-13-9-5-1-2-6-10(9)15-11-7-3-4-8-12(11)16-13/h1-8H |
| InChIKey | YCJBWNIROIXYPD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| depsidone (CHEBI:75940) is a depsidones (CHEBI:75939) |
| depsidone (CHEBI:75940) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| 11H-dibenzo[b,e][1,4]dioxepin-11-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12179 | Reaxys |
| CAS:3580-77-6 | ChemIDplus |