EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31ClN4O5 |
| Net Charge | 0 |
| Average Mass | 575.065 |
| Monoisotopic Mass | 574.19830 |
| SMILES | C[C@]1(c2ccc(Cl)cn2)Oc2cccc(C3CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@@H]4CCO4)CC3)c2O1 |
| InChI | InChI=1S/C31H31ClN4O5/c1-31(27-8-6-21(32)16-33-27)40-26-4-2-3-23(29(26)41-31)19-9-12-35(13-10-19)18-28-34-24-7-5-20(30(37)38)15-25(24)36(28)17-22-11-14-39-22/h2-8,15-16,19,22H,9-14,17-18H2,1H3,(H,37,38)/t22-,31-/m0/s1 |
| InChIKey | SVPYZAJTWFQTSM-UGDMGKLASA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lotiglipron (CHEBI:759328) has role anti-obesity agent (CHEBI:74518) |
| lotiglipron (CHEBI:759328) has role hypoglycemic agent (CHEBI:35526) |
| lotiglipron (CHEBI:759328) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| lotiglipron | WHO MedNet |
| Synonym | Source |
|---|---|
| PF-07081532 | ChEMBL |