EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40N4O6S2 |
| Net Charge | 0 |
| Average Mass | 580.773 |
| Monoisotopic Mass | 580.23893 |
| SMILES | CC(C)OC(=O)Nc1ccc(-c2cnc([C@H]3CC[C@H](NC(=O)OC(C)C)CC3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C27H40N4O6S2/c1-16(2)36-25(32)29-19-10-8-18(9-11-19)24-28-15-22(38-24)21-13-12-20(30-26(33)37-17(3)4)14-23(21)39(34,35)31-27(5,6)7/h12-19,31H,8-11H2,1-7H3,(H,29,32)(H,30,33)/t18-,19- |
| InChIKey | OVXFEICGTUUFPE-WGSAOQKQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emzadirib (CHEBI:759326) has role antineoplastic agent (CHEBI:35610) |
| emzadirib (CHEBI:759326) is a carbamate ester (CHEBI:23003) |
| INN | Source |
|---|---|
| emzadirib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cyt 0851 | ChEMBL |
| CYT-0851 | ChEMBL |
| CYT0851 | ChEMBL |