EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C74H93N7O27S4 |
| Net Charge | 0 |
| Average Mass | 1640.848 |
| Monoisotopic Mass | 1639.50022 |
| SMILES | CC1(C)C(/C=C/C2=C(Oc3ccc(C[C@H](NC(=O)[C@H](Cc4ccccc4)NC(=O)CCOCCOCCNC(=O)CC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)cc3)/C(=C/C=C3/N(CCCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)CCC2)=[N+](CCCCS(=O)(=O)[O-])c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C74H93N7O27S4/c1-73(2)54-45-52(111(100,101)102)23-27-60(54)80(35-8-10-41-109(94,95)96)62(73)29-19-49-15-12-16-50(20-30-63-74(3,4)55-46-53(112(103,104)105)24-28-61(55)81(63)36-9-11-42-110(97,98)99)67(49)108-51-21-17-48(18-22-51)44-59(71(91)92)77-68(86)58(43-47-13-6-5-7-14-47)76-65(83)33-37-106-39-40-107-38-34-75-64(82)31-25-56(69(87)88)78-72(93)79-57(70(89)90)26-32-66(84)85/h5-7,13-14,17-24,27-30,45-46,56-59H,8-12,15-16,25-26,31-44H2,1-4H3,(H12-,75,76,77,78,79,82,83,84,85,86,87,88,89,90,91,92,93,94,95,96,97,98,99,100,101,102,103,104,105)/t56-,57-,58-,59-/m0/s1 |
| InChIKey | KPIFKEKRKCVGMU-HQOHQVRUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zopocianine (CHEBI:759307) has role diagnostic imaging agent (CHEBI:37334) |
| zopocianine (CHEBI:759307) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| zopocianina | WHO MedNet |
| zopocianine | WHO MedNet |
| Synonyms | Source |
|---|---|
| OTL 0078 | ChEMBL |
| OTL-0078 | ChEMBL |
| OTL0078 | ChEMBL |
| OTL 78 | ChEMBL |
| OTL-78 | ChEMBL |
| OTL78 | ChEMBL |