EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29D3O2 |
| Net Charge | 0 |
| Average Mass | 331.514 |
| Monoisotopic Mass | 331.25906 |
| SMILES | [2H]C([2H])([2H])C(/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)=C\COC(C)=O |
| InChI | InChI=1S/C22H32O2/c1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7+,13-12+,17-9+,18-14+/i2D3 |
| InChIKey | QGNJRVVDBSJHIZ-QJZZLBIKSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gildeuretinol acetate (CHEBI:759304) has role ophthalmology drug (CHEBI:66981) |
| gildeuretinol acetate (CHEBI:759304) is a retinoid (CHEBI:26537) |
| Synonyms | Source |
|---|---|
| ALK-001 acetate | ChEMBL |
| Gildeuretinol acetate | ChEMBL |