EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36O11P2 |
| Net Charge | 0 |
| Average Mass | 550.478 |
| Monoisotopic Mass | 550.17329 |
| SMILES | [H][C@@]12Cc3c(cccc3OCC(=O)O)C[C@]1([H])[C@@H](CC[C@H](CCCCC)OP(=O)(O)O)[C@H](OP(=O)(O)O)C2 |
| InChI | InChI=1S/C23H36O11P2/c1-2-3-4-7-17(33-35(26,27)28)9-10-18-19-11-15-6-5-8-21(32-14-23(24)25)20(15)12-16(19)13-22(18)34-36(29,30)31/h5-6,8,16-19,22H,2-4,7,9-14H2,1H3,(H,24,25)(H2,26,27,28)(H2,29,30,31)/t16-,17-,18+,19-,22+/m0/s1 |
| InChIKey | IERCXWVEMYXPMR-KSSXRGRSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| treprostinil phosphate (CHEBI:759300) has role antihypertensive agent (CHEBI:35674) |
| treprostinil phosphate (CHEBI:759300) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Treprostinil bisphosphate | ChEMBL |
| Treprostinil phosphate | ChEMBL |
| UT-86 | ChEMBL |