EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C30H15O8 |
| Net Charge | 0 |
| Average Mass | 526.432 |
| Monoisotopic Mass | 526.06646 |
| SMILES | Cc1cc(O)c2c(=O)c3c(O)cc([O-])c4c5c(O)cc(O)c6c(=O)c7c(O)cc(C)c8c1c2c(c34)c(c78)c65.[Na+] |
| InChI | InChI=1S/C30H16O8.Na/c1-7-3-9(31)19-23-15(7)16-8(2)4-10(32)20-24(16)28-26-18(12(34)6-14(36)22(26)30(20)38)17-11(33)5-13(35)21(29(19)37)25(17)27(23)28;/h3-6,31-36H,1-2H3;/q;+1/p-1 |
| InChIKey | CLHLXEIQVXSPCP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypericin sodium (CHEBI:759299) has role antineoplastic agent (CHEBI:35610) |
| hypericin sodium (CHEBI:759299) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Synonym | Source |
|---|---|
| Hypericin sodium | ChEMBL |