EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H22N6O3 |
| Net Charge | 0 |
| Average Mass | 490.951 |
| Monoisotopic Mass | 490.15202 |
| SMILES | CC#CC(=O)N1CC[C@@H](n2c(=O)n(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)C1.Cl |
| InChI | InChI=1S/C25H22N6O3.ClH/c1-2-6-21(32)29-14-13-18(15-29)31-24-22(23(26)27-16-28-24)30(25(31)33)17-9-11-20(12-10-17)34-19-7-4-3-5-8-19;/h3-5,7-12,16,18H,13-15H2,1H3,(H2,26,27,28);1H/t18-;/m1./s1 |
| InChIKey | UQYDCIJFACDXSG-GMUIIQOCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tirabrutinib hydrochloride (CHEBI:759297) has role antineoplastic agent (CHEBI:35610) |
| tirabrutinib hydrochloride (CHEBI:759297) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| GS-4059 hydrochloride | ChEMBL |
| ONO-4059 hydrochloride | ChEMBL |
| Tirabrutinib hydrochloride | ChEMBL |