EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C20H23ClN4O4S |
| Net Charge | 0 |
| Average Mass | 547.055 |
| Monoisotopic Mass | 546.10097 |
| SMILES | C/C(=N\NC(=O)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1)c1cc(Cl)ccc1O.CS(=O)(=O)O |
| InChI | InChI=1S/C20H23ClN4O4S.CH4O3S/c1-14(18-13-16(21)6-7-19(18)26)22-23-20(27)15-4-3-5-17(12-15)30(28,29)25-10-8-24(2)9-11-25;1-5(2,3)4/h3-7,12-13,26H,8-11H2,1-2H3,(H,23,27);1H3,(H,2,3,4)/b22-14+; |
| InChIKey | JIPBQMGGMHCGBW-CWUUNJJBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seclidemstat mesylate (CHEBI:759290) has role antineoplastic agent (CHEBI:35610) |
| seclidemstat mesylate (CHEBI:759290) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| Seclidemstat mesilate | ChEMBL |
| Seclidemstat mesylate | ChEMBL |
| SP-2577 mesylate | ChEMBL |