EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O4 |
| Net Charge | 0 |
| Average Mass | 297.355 |
| Monoisotopic Mass | 297.16886 |
| SMILES | CC(C)C(=O)N1CCC[C@@]12CN([C@H](C(N)=O)[C@@H](C)O)C2=O |
| InChI | InChI=1S/C14H23N3O4/c1-8(2)12(20)17-6-4-5-14(17)7-16(13(14)21)10(9(3)18)11(15)19/h8-10,18H,4-7H2,1-3H3,(H2,15,19)/t9-,10+,14+/m1/s1 |
| InChIKey | NFXPEHLDVKVVKA-BFVZDQMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risevistinel (CHEBI:759286) has role antidepressant (CHEBI:35469) |
| risevistinel (CHEBI:759286) is a dipeptide (CHEBI:46761) |
| INN | Source |
|---|---|
| risevistinel | WHO MedNet |
| Synonym | Source |
|---|---|
| NYX-783 | ChEMBL |