EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O3 |
| Net Charge | 0 |
| Average Mass | 274.320 |
| Monoisotopic Mass | 274.13174 |
| SMILES | COc1ccc(CN2C[C@@]3(CCNC(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C15H18N2O3/c1-20-12-4-2-11(3-5-12)9-17-10-15(14(17)19)6-7-16-13(18)8-15/h2-5H,6-10H2,1H3,(H,16,18)/t15-/m0/s1 |
| InChIKey | HMFZRGIXXDQHFG-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nevadistinel (CHEBI:759284) has role antiparkinson drug (CHEBI:48407) |
| nevadistinel (CHEBI:759284) is a methoxybenzenes (CHEBI:51683) |
| INN | Source |
|---|---|
| nevadistinel | WHO MedNet |
| Synonyms | Source |
|---|---|
| NYX-3054 | ChEMBL |
| NYX-458 | ChEMBL |