EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClN5O3S |
| Net Charge | 0 |
| Average Mass | 469.954 |
| Monoisotopic Mass | 469.09754 |
| SMILES | CCOCc1cnc(Cl)nc1Oc1ccc2c(ccc3sc4c(c32)NC[C@@H](C)NC4=O)n1 |
| InChI | InChI=1S/C22H20ClN5O3S/c1-3-30-10-12-9-25-22(23)28-21(12)31-16-7-4-13-14(27-16)5-6-15-17(13)18-19(32-15)20(29)26-11(2)8-24-18/h4-7,9,11,24H,3,8,10H2,1-2H3,(H,26,29)/t11-/m1/s1 |
| InChIKey | PYOQIOLRFIRRSO-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamcemetinib (CHEBI:759283) has role anti-inflammatory agent (CHEBI:67079) |
| gamcemetinib (CHEBI:759283) has role antirheumatic drug (CHEBI:35842) |
| gamcemetinib (CHEBI:759283) is a quinolone (CHEBI:23765) |
| INN | Source |
|---|---|
| gamcemetinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-986371 | ChEMBL |
| CC-99677 | ChEMBL |
| Citations |
|---|