EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H26N4O4 |
| Net Charge | 0 |
| Average Mass | 410.902 |
| Monoisotopic Mass | 410.17208 |
| SMILES | C[C@@H](NC(=O)N1C(=O)[C@H](Cc2ccnc(N)c2)[C@H]1C(=O)O)C1CCCCC1.Cl |
| InChI | InChI=1S/C19H26N4O4.ClH/c1-11(13-5-3-2-4-6-13)22-19(27)23-16(18(25)26)14(17(23)24)9-12-7-8-21-15(20)10-12;/h7-8,10-11,13-14,16H,2-6,9H2,1H3,(H2,20,21)(H,22,27)(H,25,26);1H/t11-,14-,16+;/m1./s1 |
| InChIKey | DKVCWNHVUVKKRJ-WRVPCBEASA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| frunexian hydrochloride (CHEBI:759282) is a monobactam (CHEBI:50695) |
| Synonyms | Source |
|---|---|
| EP-7041 HCl | ChEMBL |
| Frunexian hydrochloride | ChEMBL |