EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O4 |
| Net Charge | 0 |
| Average Mass | 374.441 |
| Monoisotopic Mass | 374.19541 |
| SMILES | C[C@@H](NC(=O)N1C(=O)[C@H](Cc2ccnc(N)c2)[C@H]1C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C19H26N4O4/c1-11(13-5-3-2-4-6-13)22-19(27)23-16(18(25)26)14(17(23)24)9-12-7-8-21-15(20)10-12/h7-8,10-11,13-14,16H,2-6,9H2,1H3,(H2,20,21)(H,22,27)(H,25,26)/t11-,14-,16+/m1/s1 |
| InChIKey | NYPSZHLKEMYZKK-XFJVYGCCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| frunexian (CHEBI:759281) has role antiviral agent (CHEBI:22587) |
| frunexian (CHEBI:759281) is a monobactam (CHEBI:50695) |
| INN | Source |
|---|---|
| frunexian | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ep 7041 | ChEMBL |
| EP-7041 | ChEMBL |
| Citations |
|---|