EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39N5O6S2 |
| Net Charge | 0 |
| Average Mass | 581.761 |
| Monoisotopic Mass | 581.23418 |
| SMILES | [H][C@@]1(/C=C/CCSC(=O)[C@@H](N)C(C)C)CC(=O)NCc2nc(cs2)C(=O)NC(C)(C)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C26H39N5O6S2/c1-14(2)20(27)24(35)38-10-8-7-9-16-11-18(32)28-12-19-29-17(13-39-19)22(33)31-26(5,6)25(36)30-21(15(3)4)23(34)37-16/h7,9,13-16,20-21H,8,10-12,27H2,1-6H3,(H,28,32)(H,30,36)(H,31,33)/b9-7+/t16-,20+,21+/m1/s1 |
| InChIKey | YBLKKAYDPCHCJG-IQGTVIFDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bocodepsin (CHEBI:759279) has role antineoplastic agent (CHEBI:35610) |
| bocodepsin (CHEBI:759279) is a cyclodepsipeptide (CHEBI:35213) |
| INNs | Source |
|---|---|
| bocodepsin | WHO MedNet |
| bocodepsina | WHO MedNet |
| bocodepsine | WHO MedNet |
| Synonym | Source |
|---|---|
| OKI-006 | ChEMBL |