EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HBr.C18H22N2S.C18H22N2S |
| Net Charge | 0 |
| Average Mass | 677.822 |
| Monoisotopic Mass | 676.22690 |
| SMILES | Br.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/2C18H22N2S.BrH/c2*1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;/h2*3-8,13,19H,9-12H2,1-2H3;1H |
| InChIKey | PVBHSIUFZYWKHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vortioxetine hemihydrobromide (CHEBI:759276) has role antidepressant (CHEBI:35469) |
| vortioxetine hemihydrobromide (CHEBI:759276) has role anxiolytic drug (CHEBI:35474) |
| vortioxetine hemihydrobromide (CHEBI:759276) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| SF-001 | ChEMBL |
| SF001 | ChEMBL |
| Vortioxetine bromide | ChEMBL |
| Vortioxetine hemihydrobromide | ChEMBL |