EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18F6N2O5S |
| Net Charge | 0 |
| Average Mass | 512.428 |
| Monoisotopic Mass | 512.08406 |
| SMILES | [H][C@]12CN(C(=O)c3cc(S(C)(=O)=O)ccc3O[C@H](C)C(F)(F)F)C[C@@]1(c1cc(C(F)(F)F)on1)C2 |
| InChI | InChI=1S/C20H18F6N2O5S/c1-10(19(21,22)23)32-14-4-3-12(34(2,30)31)5-13(14)17(29)28-8-11-7-18(11,9-28)15-6-16(33-27-15)20(24,25)26/h3-6,10-11H,7-9H2,1-2H3/t10-,11+,18+/m1/s1 |
| InChIKey | MYHDQTVHHMSLEF-DDBGAENHSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iclepertin (CHEBI:759274) has role antipsychotic agent (CHEBI:35476) |
| iclepertin (CHEBI:759274) is a N-acylpiperidine (CHEBI:48591) |
| Synonyms | Source |
|---|---|
| BI 425809 | ChEMBL |
| Iclepertin | ChEMBL |