EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H67FN2O4S.CH4O3S |
| Net Charge | 0 |
| Average Mass | 823.191 |
| Monoisotopic Mass | 822.46867 |
| SMILES | CS(=O)(=O)O.[H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(NCCN5CCS(=O)(=O)CC5)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(C3=CC[C@@](CF)(C(=O)O)CC3)=CC[C@]21C |
| InChI | InChI=1S/C43H67FN2O4S.CH4O3S/c1-29(2)31-12-19-43(45-22-23-46-24-26-51(49,50)27-25-46)21-20-40(6)33(36(31)43)8-9-35-39(5)15-13-32(38(3,4)34(39)14-16-41(35,40)7)30-10-17-42(28-44,18-11-30)37(47)48;1-5(2,3)4/h10,13,31,33-36,45H,1,8-9,11-12,14-28H2,2-7H3,(H,47,48);1H3,(H,2,3,4)/t31-,33+,34-,35+,36+,39-,40+,41+,42+,43-;/m0./s1 |
| InChIKey | KZPYHBDXQJFELM-IZWZCXDRSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fipravirimat mesylate (CHEBI:759273) has role anti-HIV agent (CHEBI:64946) |
| fipravirimat mesylate (CHEBI:759273) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| Fipravirimat mesylate | ChEMBL |
| GSK-3640254D | ChEMBL |
| GSK3640254D | ChEMBL |
| GSK-3640254 MESYLATE | ChEMBL |
| GSK3640254 MESYLATE | ChEMBL |