EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26ClN5O3 |
| Net Charge | 0 |
| Average Mass | 455.946 |
| Monoisotopic Mass | 455.17242 |
| SMILES | [H][C@@]1(C[C@@H](C#N)NC(=O)[C@H](CC2CC2)NC(=O)c2cc3cccc(Cl)c3n2)CCCNC1=O |
| InChI | InChI=1S/C23H26ClN5O3/c24-17-5-1-3-14-11-19(28-20(14)17)23(32)29-18(9-13-6-7-13)22(31)27-16(12-25)10-15-4-2-8-26-21(15)30/h1,3,5,11,13,15-16,18,28H,2,4,6-10H2,(H,26,30)(H,27,31)(H,29,32)/t15-,16-,18-/m0/s1 |
| InChIKey | BNMFQWUHWYJTRI-BQFCYCMXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pomotrelvir (CHEBI:759266) has role anticoronaviral agent (CHEBI:149553) |
| pomotrelvir (CHEBI:759266) has role antiviral agent (CHEBI:22587) |
| pomotrelvir (CHEBI:759266) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Pbi 0451 | ChEMBL |
| PBI-0451 | ChEMBL |
| Pomotrelvir | ChEMBL |
| Citations |
|---|