EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35ClFN7O3 |
| Net Charge | 0 |
| Average Mass | 584.096 |
| Monoisotopic Mass | 583.24739 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(Nc3cc(Cl)c(F)cc3C(C)(C)O)n2)c(OC)cc1N1CC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C29H35ClFN7O3/c1-7-27(39)34-22-14-23(25(41-6)15-24(22)38-11-9-17(16-38)37(4)5)35-28-32-10-8-26(36-28)33-21-13-19(30)20(31)12-18(21)29(2,3)40/h7-8,10,12-15,17,40H,1,9,11,16H2,2-6H3,(H,34,39)(H2,32,33,35,36)/t17-/m1/s1 |
| InChIKey | BTMKEDDEMKKSEF-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sunvozertinib (CHEBI:759262) has role antineoplastic agent (CHEBI:35610) |
| sunvozertinib (CHEBI:759262) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| 122507 | ChEMBL |
| A-1801 | ChEMBL |
| A1801 | ChEMBL |
| ASYM-122507 | ChEMBL |
| DZ00000586 | ChEMBL |
| DZ'0586 | ChEMBL |
| Citations |
|---|