EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759261 - zosurabalpin
| Formula | C43H50N8O5S |
| Net Charge | 0 |
| Average Mass | 790.991 |
| Monoisotopic Mass | 790.36249 |
| SMILES | CN1C(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN)NCc2cccnc2Sc2cccc(-c3ccc(C(=O)O)cc3)c2CNC(=O)[C@@H]1Cc1cnc2ccccc12 |
| InChI | InChI=1S/C43H50N8O5S/c1-51-37(23-30-25-47-34-12-3-2-10-32(30)34)40(53)49-26-33-31(27-16-18-28(19-17-27)43(55)56)11-6-15-38(33)57-41-29(9-8-22-46-41)24-48-35(14-7-21-45)39(52)50-36(42(51)54)13-4-5-20-44/h2-3,6,8-12,15-19,22,25,35-37,47-48H,4-5,7,13-14,20-21,23-24,26,44-45H2,1H3,(H,49,53)(H,50,52)(H,55,56)/t35-,36-,37-/m0/s1 |
| InChIKey | NJFUXFYUHIHHOJ-FSEITFBQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zosurabalpin (CHEBI:759261) has role antibacterial agent (CHEBI:33282) |
| zosurabalpin (CHEBI:759261) is a oligopeptide (CHEBI:25676) |
| INNs | Source |
|---|---|
| zosurabalpin | WHO MedNet |
| zosurabalpina | WHO MedNet |
| zosurabalpine | WHO MedNet |
| Synonyms | Source |
|---|---|
| RG-6006 | ChEMBL |
| RG6006 | ChEMBL |
| RO-7223280 | ChEMBL |
| RO7223280 | ChEMBL |
| Citations |
|---|