EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C9H13NOS |
| Net Charge | 0 |
| Average Mass | 219.737 |
| Monoisotopic Mass | 219.04846 |
| SMILES | CNC[C@@H]1OCCc2ccsc21.Cl |
| InChI | InChI=1S/C9H13NOS.ClH/c1-10-6-8-9-7(2-4-11-8)3-5-12-9;/h3,5,8,10H,2,4,6H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | JRDQGVVFSHRVTL-QRPNPIFTSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulotaront hydrochloride (CHEBI:759259) has role antidepressant (CHEBI:35469) |
| ulotaront hydrochloride (CHEBI:759259) has role antiparkinson drug (CHEBI:48407) |
| ulotaront hydrochloride (CHEBI:759259) has role antipsychotic agent (CHEBI:35476) |
| ulotaront hydrochloride (CHEBI:759259) is a thienopyran (CHEBI:48910) |
| Synonyms | Source |
|---|---|
| SEP-363856-01 | ChEMBL |
| SEP-363856 HYDROCHLORIDE | ChEMBL |
| Ulotaront hydrochloride | ChEMBL |