EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C9H13NOS |
| Net Charge | 0 |
| Average Mass | 219.737 |
| Monoisotopic Mass | 219.04846 |
| SMILES | CNC[C@@H]1OCCc2ccsc21.Cl |
| InChI | InChI=1S/C9H13NOS.ClH/c1-10-6-8-9-7(2-4-11-8)3-5-12-9;/h3,5,8,10H,2,4,6H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | JRDQGVVFSHRVTL-QRPNPIFTSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulotaront hydrochloride (CHEBI:759259) has role antidepressant (CHEBI:35469) |
| ulotaront hydrochloride (CHEBI:759259) has role antiparkinson drug (CHEBI:48407) |
| ulotaront hydrochloride (CHEBI:759259) has role antipsychotic agent (CHEBI:35476) |
| ulotaront hydrochloride (CHEBI:759259) is a thienopyran (CHEBI:48910) |
| Synonyms | Source |
|---|---|
| SEP-363856-01 | ChEMBL |
| SEP-363856 HYDROCHLORIDE | ChEMBL |
| Ulotaront hydrochloride | ChEMBL |