EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24FN7O2 |
| Net Charge | 0 |
| Average Mass | 509.545 |
| Monoisotopic Mass | 509.19755 |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2c(-c3ccc(Oc4nccc(C)n4)c(F)c3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C28H24FN7O2/c1-15(2)27(37)35-19-8-5-17(6-9-19)24-22(23-25(30)32-14-33-26(23)36(24)4)18-7-10-21(20(29)13-18)38-28-31-12-11-16(3)34-28/h5-14H,1H2,2-4H3,(H,35,37)(H2,30,32,33) |
| InChIKey | XOQVZSSDIQQUGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lirafugratinib (CHEBI:759255) has role antineoplastic agent (CHEBI:35610) |
| lirafugratinib (CHEBI:759255) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| lirafugratinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Rly 4008 | ChEMBL |
| RLY-4008 | ChEMBL |
| RLY4008 | ChEMBL |
| Citations |
|---|