EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34F3N5O4 |
| Net Charge | 0 |
| Average Mass | 513.561 |
| Monoisotopic Mass | 513.25629 |
| SMILES | CCC[C@@H](CCO)Nc1nc(N)nc(C)c1Cc1ccc(CN(CC(=O)O)CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C24H34F3N5O4/c1-4-5-18(8-9-33)30-22-19(15(2)29-23(28)31-22)11-17-7-6-16(10-20(17)36-3)12-32(13-21(34)35)14-24(25,26)27/h6-7,10,18,33H,4-5,8-9,11-14H2,1-3H3,(H,34,35)(H3,28,29,30,31)/t18-/m0/s1 |
| InChIKey | XWGKZKKNJOQUSG-SFHVURJKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guretolimod (CHEBI:759254) has role antineoplastic agent (CHEBI:35610) |
| guretolimod (CHEBI:759254) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| DSP-0509 | ChEMBL |
| DSP0509 | ChEMBL |
| DSR-106509 | ChEMBL |
| Guretolimod | ChEMBL |