EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21F3N4O4S |
| Net Charge | 0 |
| Average Mass | 494.495 |
| Monoisotopic Mass | 494.12356 |
| SMILES | CCCS(=O)(=O)Nc1cc(F)c(F)c(C(=O)c2ccc3ncc(N4CCOCC4)nc3c2)c1F |
| InChI | InChI=1S/C22H21F3N4O4S/c1-2-9-34(31,32)28-17-11-14(23)20(24)19(21(17)25)22(30)13-3-4-15-16(10-13)27-18(12-26-15)29-5-7-33-8-6-29/h3-4,10-12,28H,2,5-9H2,1H3 |
| InChIKey | HAYBWDINAFTFCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uplarafenib (CHEBI:759248) has role antineoplastic agent (CHEBI:35610) |
| uplarafenib (CHEBI:759248) is a benzophenones (CHEBI:22726) |
| INN | Source |
|---|---|
| uplarafenib | WHO MedNet |