EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32F2N8 |
| Net Charge | 0 |
| Average Mass | 518.616 |
| Monoisotopic Mass | 518.27180 |
| SMILES | CCN1CCN(Cc2ccc(Nc3ncc(F)c(-c4cc(F)c5nc6n(c5c4)[C@H](C)CCC6)n3)nc2)CC1 |
| InChI | InChI=1S/C28H32F2N8/c1-3-36-9-11-37(12-10-36)17-19-7-8-24(31-15-19)33-28-32-16-22(30)26(35-28)20-13-21(29)27-23(14-20)38-18(2)5-4-6-25(38)34-27/h7-8,13-16,18H,3-6,9-12,17H2,1-2H3,(H,31,32,33,35)/t18-/m1/s1 |
| InChIKey | XOJPAVACYRFOBK-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tibremciclib (CHEBI:759246) has role antineoplastic agent (CHEBI:35610) |
| tibremciclib (CHEBI:759246) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| tibremciclib | WHO MedNet |