EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11FN2O5S |
| Net Charge | 0 |
| Average Mass | 326.305 |
| Monoisotopic Mass | 326.03727 |
| SMILES | COc1ccc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2c1 |
| InChI | InChI=1S/C13H11FN2O5S/c1-21-8-3-2-7-4-10(17)13(12(14)9(7)5-8)16-6-11(18)15-22(16,19)20/h2-5,17H,6H2,1H3,(H,15,18) |
| InChIKey | CPLSFGHDGOFDRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tegeprotafib (CHEBI:759244) has role antineoplastic agent (CHEBI:35610) |
| tegeprotafib (CHEBI:759244) is a naphthols (CHEBI:25392) |
| INN | Source |
|---|---|
| tegeprotafib | WHO MedNet |