EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36N6O3 |
| Net Charge | 0 |
| Average Mass | 528.657 |
| Monoisotopic Mass | 528.28489 |
| SMILES | CC(C)[C@H](C(=O)Nc1cc(C2CC2)nn1)c1cccc(-c2ccc(NC(=O)/C=C/CN3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C30H36N6O3/c1-20(2)29(30(38)33-27-18-25(34-35-27)21-8-9-21)23-6-3-5-22(17-23)24-10-11-26(31-19-24)32-28(37)7-4-12-36-13-15-39-16-14-36/h3-7,10-11,17-21,29H,8-9,12-16H2,1-2H3,(H,31,32,37)(H2,33,34,35,38)/b7-4+/t29-/m0/s1 |
| InChIKey | CVAXNGIXLUILFO-KPGJNUASSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tacaciclib (CHEBI:759242) has role antineoplastic agent (CHEBI:35610) |
| tacaciclib (CHEBI:759242) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| tacaciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AUR-102 | ChEMBL |
| AUR102 | ChEMBL |