EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H51N9O5 |
| Net Charge | 0 |
| Average Mass | 761.928 |
| Monoisotopic Mass | 761.40132 |
| SMILES | C=CC(=O)Nc1cc(Nc2nc(-c3ccnc(N4CCn5c(cc6c5CC(C)(C)C6)C4=O)c3CO)cn(C)c2=O)ccc1N1CCN(C2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C42H51N9O5/c1-6-37(53)45-32-20-28(7-8-34(32)49-14-13-48(23-26(49)2)29-10-17-56-18-11-29)44-38-41(55)47(5)24-33(46-38)30-9-12-43-39(31(30)25-52)51-16-15-50-35(40(51)54)19-27-21-42(3,4)22-36(27)50/h6-9,12,19-20,24,26,29,52H,1,10-11,13-18,21-23,25H2,2-5H3,(H,44,46)(H,45,53)/t26-/m0/s1 |
| InChIKey | OYJVFTNYBWVQHA-SANMLTNESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rocbrutinib (CHEBI:759240) has role antineoplastic agent (CHEBI:35610) |
| rocbrutinib (CHEBI:759240) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| rocbrutinib | WHO MedNet |