EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31F4N5O2 |
| Net Charge | 0 |
| Average Mass | 545.581 |
| Monoisotopic Mass | 545.24139 |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc3c(N[C@@H]4CCN(C)C[C@@H]4F)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C28H31F4N5O2/c1-33-27(38)18-9-10-24(26(14-18)39-3)34-12-5-6-19-15-20-22(35-23-11-13-36(2)16-21(23)29)7-4-8-25(20)37(19)17-28(30,31)32/h4,7-10,14-15,21,23,34-35H,11-13,16-17H2,1-3H3,(H,33,38)/t21-,23+/m0/s1 |
| InChIKey | NKRKBSQLUPEVCZ-JTHBVZDNSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rezatapopt (CHEBI:759239) has role antineoplastic agent (CHEBI:35610) |
| rezatapopt (CHEBI:759239) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| rezatapopt | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pc 14586 | ChEMBL |
| PC-14586 | ChEMBL |
| PC14586 | ChEMBL |