EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27F2N7O3 |
| Net Charge | 0 |
| Average Mass | 523.544 |
| Monoisotopic Mass | 523.21434 |
| SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3c(F)cc4c(ncn4C4CC4)c3F)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C26H27F2N7O3/c1-4-21(36)33-11-15(9-16(33)12-38-3)35-26(30-2)22(25(29)37)19(32-35)8-7-17-18(27)10-20-24(23(17)28)31-13-34(20)14-5-6-14/h4,10,13-16,30H,1,5-6,9,11-12H2,2-3H3,(H2,29,37)/t15-,16+/m0/s1 |
| InChIKey | YXVDEILMUVTDMK-JKSUJKDBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resigratinib (CHEBI:759238) has role antineoplastic agent (CHEBI:35610) |
| resigratinib (CHEBI:759238) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| resigratinib | WHO MedNet |
| Citations |
|---|