EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | CCCCCOc1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H18O3/c1-3-4-5-9-16-12-8-6-7-11(10(12)2)13(14)15/h6-8H,3-5,9H2,1-2H3,(H,14,15) |
| InChIKey | JYEFZVSYKCEGEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orziloben (CHEBI:759235) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| orziloben | WHO MedNet |
| orzilobene | WHO MedNet |