EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O5S |
| Net Charge | 0 |
| Average Mass | 418.515 |
| Monoisotopic Mass | 418.15624 |
| SMILES | CS(=O)(=O)N1CCC(COc2coc(CN3Cc4ccccc4C3)cc2=O)CC1 |
| InChI | InChI=1S/C21H26N2O5S/c1-29(25,26)23-8-6-16(7-9-23)14-28-21-15-27-19(10-20(21)24)13-22-11-17-4-2-3-5-18(17)12-22/h2-5,10,15-16H,6-9,11-14H2,1H3 |
| InChIKey | LHVKCOBGLZGRQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opevesostat (CHEBI:759234) has role antineoplastic agent (CHEBI:35610) |
| opevesostat (CHEBI:759234) is a isoindoles (CHEBI:24897) |
| INN | Source |
|---|---|
| opevesostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Odm-208 | ChEMBL |
| ODM208 | ChEMBL |