EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759233 - nerandomilast
| Formula | C20H25ClN6O2S |
| Net Charge | 0 |
| Average Mass | 448.980 |
| Monoisotopic Mass | 448.14482 |
| SMILES | [O-][S+]1CCc2nc(N3CCC(c4ncc(Cl)cn4)CC3)nc(NC3(CO)CCC3)c21 |
| InChI | InChI=1S/C20H25ClN6O2S/c21-14-10-22-17(23-11-14)13-2-7-27(8-3-13)19-24-15-4-9-30(29)16(15)18(25-19)26-20(12-28)5-1-6-20/h10-11,13,28H,1-9,12H2,(H,24,25,26) |
| InChIKey | UHYCLWAANUGUMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nerandomilast (CHEBI:759233) has role antifibrotic agent (CHEBI:233423) |
| nerandomilast (CHEBI:759233) is a dialkylarylamine (CHEBI:23665) |
| nerandomilast (CHEBI:759233) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| nerandomilast | WHO MedNet |
| Synonym | Source |
|---|---|
| BI-1015550 | ChEMBL |