EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H54FN7O6 |
| Net Charge | 0 |
| Average Mass | 807.968 |
| Monoisotopic Mass | 807.41196 |
| SMILES | COc1cc(O[C@H]2C(C)(C)[C@H](NC(=O)c3ccc(N4CCC(CN5CCN(c6ccc(C(=O)N[C@H]7CCC(=O)NC7=O)c(F)c6)CC5)CC4)cc3)C2(C)C)ccc1C#N |
| InChI | InChI=1S/C45H54FN7O6/c1-44(2)42(45(3,4)43(44)59-33-12-8-30(26-47)37(25-33)58-5)50-39(55)29-6-9-31(10-7-29)52-18-16-28(17-19-52)27-51-20-22-53(23-21-51)32-11-13-34(35(46)24-32)40(56)48-36-14-15-38(54)49-41(36)57/h6-13,24-25,28,36,42-43H,14-23,27H2,1-5H3,(H,48,56)(H,50,55)(H,49,54,57)/t36-,42-,43-/m0/s1 |
| InChIKey | RDPPBRKNBBXPNZ-FMPIRMQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luxdegalutamide (CHEBI:759231) has role antineoplastic agent (CHEBI:35610) |
| luxdegalutamide (CHEBI:759231) is a N-acyl-amino acid (CHEBI:51569) |
| INNs | Source |
|---|---|
| luxdegalutamida | WHO MedNet |
| luxdegalutamide | WHO MedNet |
| Citations |
|---|