EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20FN3O2 |
| Net Charge | 0 |
| Average Mass | 365.408 |
| Monoisotopic Mass | 365.15396 |
| SMILES | C[C@]1(c2ccc(-c3nc4cc(F)cc5c4c3CONC5=O)cc2)CCCN1 |
| InChI | InChI=1S/C21H20FN3O2/c1-21(7-2-8-23-21)13-5-3-12(4-6-13)19-16-11-27-25-20(26)15-9-14(22)10-17(24-19)18(15)16/h3-6,9-10,23-24H,2,7-8,11H2,1H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | FBKICCXLQKLXAZ-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lerzeparib (CHEBI:759229) has role antineoplastic agent (CHEBI:35610) |
| lerzeparib (CHEBI:759229) is a pyrrolidines (CHEBI:38260) |
| INN | Source |
|---|---|
| lerzeparib | WHO MedNet |