EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46N4O4 |
| Net Charge | 0 |
| Average Mass | 550.744 |
| Monoisotopic Mass | 550.35191 |
| SMILES | CCN(c1cc(O[C@H]2C[C@H](N3CCCCC3)C2)cc(C(=O)NCc2c(C)cc(C)nc2=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C32H46N4O4/c1-5-36(24-9-13-39-14-10-24)30-19-27(40-26-16-25(17-26)35-11-7-6-8-12-35)18-28(23(30)4)31(37)33-20-29-21(2)15-22(3)34-32(29)38/h15,18-19,24-26H,5-14,16-17,20H2,1-4H3,(H,33,37)(H,34,38)/t25-,26- |
| InChIKey | YGNGDDWFJFOIGX-DIVCQZSQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| igermetostat (CHEBI:759224) has role antineoplastic agent (CHEBI:35610) |
| igermetostat (CHEBI:759224) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| igermetostat | WHO MedNet |