EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H26ClF4N7O2 |
| Net Charge | 0 |
| Average Mass | 640.041 |
| Monoisotopic Mass | 639.17726 |
| SMILES | C=CC(=O)N1CCN(c2c(C#N)c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4c(N)c(F)c(F)c(F)c4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C31H26ClF4N7O2/c1-5-19(44)41-8-10-42(11-9-41)29-16-12-18(32)27(20-21(33)22(34)23(35)24(36)25(20)38)40-30(16)43(31(45)17(29)13-37)28-15(4)6-7-39-26(28)14(2)3/h5-7,12,14H,1,8-11,38H2,2-4H3 |
| InChIKey | QRRJEUIQLZNPIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glecirasib (CHEBI:759222) has role antineoplastic agent (CHEBI:35610) |
| glecirasib (CHEBI:759222) is a piperazines (CHEBI:26144) |
| glecirasib (CHEBI:759222) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| glecirasib | WHO MedNet |