EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26BF2N3O7 |
| Net Charge | 0 |
| Average Mass | 481.261 |
| Monoisotopic Mass | 481.18319 |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H]1CCN1c1ccc(F)cc1F)B1OC(=O)[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C21H26BF2N3O7/c1-11(2)7-17(22-33-16(9-19(29)30)21(32)34-22)26-18(28)10-25-20(31)15-5-6-27(15)14-4-3-12(23)8-13(14)24/h3-4,8,11,15-17H,5-7,9-10H2,1-2H3,(H,25,31)(H,26,28)(H,29,30)/t15-,16-,17-/m0/s1 |
| InChIKey | BMSAGHWUHGTMIV-ULQDDVLXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| davelizomib (CHEBI:759219) has role antineoplastic agent (CHEBI:35610) |
| davelizomib (CHEBI:759219) is a dipeptide (CHEBI:46761) |
| INN | Source |
|---|---|
| davelizomib | WHO MedNet |