EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22ClN7O2 |
| Net Charge | 0 |
| Average Mass | 463.929 |
| Monoisotopic Mass | 463.15235 |
| SMILES | N#CN1C[C@H](n2nc(-c3ccc(Oc4ccc(Cl)cn4)cc3)c(C(N)=O)c2N)CCC12CC2 |
| InChI | InChI=1S/C23H22ClN7O2/c24-15-3-6-18(28-11-15)33-17-4-1-14(2-5-17)20-19(22(27)32)21(26)31(29-20)16-7-8-23(9-10-23)30(12-16)13-25/h1-6,11,16H,7-10,12,26H2,(H2,27,32)/t16-/m1/s1 |
| InChIKey | OSEITUBGGJDFBK-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| civorebrutinib (CHEBI:759216) has role antineoplastic agent (CHEBI:35610) |
| civorebrutinib (CHEBI:759216) is a pyrazoles (CHEBI:26410) |
| civorebrutinib (CHEBI:759216) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| civorebrutinib | WHO MedNet |