EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | C=CC(=O)N1CCC[C@@H](c2c(F)cc(C(N)=O)c3nc4c(c23)CCCCC4)C1 |
| InChI | InChI=1S/C22H26FN3O2/c1-2-18(27)26-10-6-7-13(12-26)19-16(23)11-15(22(24)28)21-20(19)14-8-4-3-5-9-17(14)25-21/h2,11,13,25H,1,3-10,12H2,(H2,24,28)/t13-/m1/s1 |
| InChIKey | NEHJPDSXWUIXGI-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinsebrutinib (CHEBI:759215) has role antineoplastic agent (CHEBI:35610) |
| cinsebrutinib (CHEBI:759215) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| cinsebrutinib | WHO MedNet |