EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:759210 - bevemipretide
| Formula | C31H45N9O4 |
| Net Charge | 0 |
| Average Mass | 607.760 |
| Monoisotopic Mass | 607.35945 |
| SMILES | Cc1cc(O)cc(C)c1C[C@@H](C(N)=O)N(C(=O)[C@H](N)CCCNC(=N)N)[C@@H](CCCCN)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C31H45N9O4/c1-19-15-22(41)16-20(2)23(19)18-26(28(34)42)40(30(43)24(33)11-8-14-37-31(35)36)25(12-6-7-13-32)29-38-27(39-44-29)17-21-9-4-3-5-10-21/h3-5,9-10,15-16,24-26,41H,6-8,11-14,17-18,32-33H2,1-2H3,(H2,34,42)(H4,35,36,37)/t24-,25+,26+/m1/s1 |
| InChIKey | CXBABAXVIWMOOZ-ZNZIZOMTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bevemipretide (CHEBI:759210) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| bevemipretida | WHO MedNet |
| bevemipretide | WHO MedNet |
| Synonym | Source |
|---|---|
| SBT-272 | ChEMBL |