EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20N6 |
| Net Charge | 0 |
| Average Mass | 416.488 |
| Monoisotopic Mass | 416.17494 |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1-c1cccc2c(N)nc(Nc3ccc(C#N)cc3)nc12 |
| InChI | InChI=1S/C26H20N6/c1-16-13-19(5-4-12-27)14-17(2)23(16)21-6-3-7-22-24(21)31-26(32-25(22)29)30-20-10-8-18(15-28)9-11-20/h3-11,13-14H,1-2H3,(H3,29,30,31,32)/b5-4+ |
| InChIKey | HKETUZQMIFPGNG-SNAWJCMRSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bavtavirine (CHEBI:759208) has role anti-HIV agent (CHEBI:64946) |
| bavtavirine (CHEBI:759208) has role antiviral agent (CHEBI:22587) |
| bavtavirine (CHEBI:759208) is a quinazolines (CHEBI:38530) |
| INNs | Source |
|---|---|
| bavtavirina | WHO MedNet |
| bavtavirine | WHO MedNet |