EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N4O5 |
| Net Charge | 0 |
| Average Mass | 582.701 |
| Monoisotopic Mass | 582.28422 |
| SMILES | CCOc1c(C(=O)O)cnn1-c1cccc(-c2cccc(C)c2OCc2ccc3c(c2C)CCN(C2CCOCC2)C3)n1 |
| InChI | InChI=1S/C34H38N4O5/c1-4-42-33-29(34(39)40)19-35-38(33)31-10-6-9-30(36-31)28-8-5-7-22(2)32(28)43-21-25-12-11-24-20-37(16-13-27(24)23(25)3)26-14-17-41-18-15-26/h5-12,19,26H,4,13-18,20-21H2,1-3H3,(H,39,40) |
| InChIKey | KWNFFNFBUMFTHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenciguat (CHEBI:759207) has role antihypertensive agent (CHEBI:35674) |
| avenciguat (CHEBI:759207) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| avenciguat | WHO MedNet |