EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H29N9O2 |
| Net Charge | 0 |
| Average Mass | 535.612 |
| Monoisotopic Mass | 535.24442 |
| SMILES | C=CC(=O)NC1CCN(c2ncc3ncnc(Nc4ccc(Oc5ccc6c(c5)ncn6C)c(C)c4)c3n2)CC1 |
| InChI | InChI=1S/C29H29N9O2/c1-4-26(39)34-19-9-11-38(12-10-19)29-30-15-23-27(36-29)28(32-16-31-23)35-20-5-8-25(18(2)13-20)40-21-6-7-24-22(14-21)33-17-37(24)3/h4-8,13-17,19H,1,9-12H2,2-3H3,(H,34,39)(H,31,32,35) |
| InChIKey | YSGNGFPNTLERCR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zongertinib (CHEBI:759202) has role antineoplastic agent (CHEBI:35610) |
| zongertinib (CHEBI:759202) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| zongertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BI 1810631 | ChEMBL |
| BI-1810631 | ChEMBL |
| BI1810631 | ChEMBL |