EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759199 - zavondemstat
| Formula | C26H29N3O3 |
| Net Charge | 0 |
| Average Mass | 431.536 |
| Monoisotopic Mass | 431.22089 |
| SMILES | CC(C)c1ccc(N(C)c2ccc3c(c2)OCC[C@H]3CNc2cnccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-17(2)18-4-6-20(7-5-18)29(3)21-8-9-22-19(11-13-32-25(22)14-21)15-28-24-16-27-12-10-23(24)26(30)31/h4-10,12,14,16-17,19,28H,11,13,15H2,1-3H3,(H,30,31)/t19-/m0/s1 |
| InChIKey | NDVITLLKZQXKGU-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zavondemstat (CHEBI:759199) has role antineoplastic agent (CHEBI:35610) |
| zavondemstat (CHEBI:759199) is a aromatic amine (CHEBI:33860) |
| zavondemstat (CHEBI:759199) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| zavondemstat | WHO MedNet |