EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24N2O3S |
| Net Charge | 0 |
| Average Mass | 420.534 |
| Monoisotopic Mass | 420.15076 |
| SMILES | CCc1cc2c(=O)c(-c3nc4ccccc4s3)coc2c(CN2CCCCC2)c1O |
| InChI | InChI=1S/C24H24N2O3S/c1-2-15-12-16-22(28)18(24-25-19-8-4-5-9-20(19)30-24)14-29-23(16)17(21(15)27)13-26-10-6-3-7-11-26/h4-5,8-9,12,14,27H,2-3,6-7,10-11,13H2,1H3 |
| InChIKey | JKIXLEKBXHMXTN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.3.2.19 (ubiquitin--protein ligase) inhibitor An enzyme inhibitor that interferes with the action of ubiquitin—protein ligase (EC 6.3.2.19). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SZL-P1-41 (CHEBI:75919) has role antineoplastic agent (CHEBI:35610) |
| SZL-P1-41 (CHEBI:75919) has role EC 6.3.2.19 (ubiquitin—protein ligase) inhibitor (CHEBI:75968) |
| SZL-P1-41 (CHEBI:75919) is a benzothiazoles (CHEBI:37947) |
| SZL-P1-41 (CHEBI:75919) is a chromones (CHEBI:23238) |
| SZL-P1-41 (CHEBI:75919) is a phenols (CHEBI:33853) |
| SZL-P1-41 (CHEBI:75919) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 3-(1,3-benzothiazol-2-yl)-6-ethyl-7-hydroxy-8-(piperidin-1-ylmethyl)-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8292462 | Reaxys |
| Citations |
|---|