EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33N3O4S |
| Net Charge | 0 |
| Average Mass | 519.667 |
| Monoisotopic Mass | 519.21918 |
| SMILES | COc1cc(/C=C/c2ccc(S(=O)(=O)N3CCN(CCO)CC3)cc2)ccc1/C=C/c1ccc(N)cc1 |
| InChI | InChI=1S/C29H33N3O4S/c1-36-29-22-25(5-11-26(29)10-4-24-6-12-27(30)13-7-24)3-2-23-8-14-28(15-9-23)37(34,35)32-18-16-31(17-19-32)20-21-33/h2-15,22,33H,16-21,30H2,1H3/b3-2+,10-4+ |
| InChIKey | UQCMMQGPTBKIAK-KHVHPYDTSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rizedisben (CHEBI:759189) has role antineoplastic agent (CHEBI:35610) |
| rizedisben (CHEBI:759189) has role diagnostic imaging agent (CHEBI:37334) |
| rizedisben (CHEBI:759189) is a stilbenoid (CHEBI:26776) |
| INNs | Source |
|---|---|
| rizedisben | WHO MedNet |
| rizedisbene | WHO MedNet |
| Synonyms | Source |
|---|---|
| GE-3126 | ChEMBL |
| GE3126 | ChEMBL |
| Illuminare-1 | ChEMBL |