EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34N8O2 |
| Net Charge | 0 |
| Average Mass | 574.689 |
| Monoisotopic Mass | 574.28047 |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nccc(-c2cncc(-c3oncc3C)c2)n1 |
| InChI | InChI=1S/C33H34N8O2/c1-22-4-9-28(37-32(42)25-7-5-24(6-8-25)21-41-14-12-40(3)13-15-41)17-30(22)39-33-35-11-10-29(38-33)26-16-27(20-34-19-26)31-23(2)18-36-43-31/h4-11,16-20H,12-15,21H2,1-3H3,(H,37,42)(H,35,38,39) |
| InChIKey | ADGOPPKEIZXKAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risvodetinib (CHEBI:759187) has role antiparkinson drug (CHEBI:48407) |
| risvodetinib (CHEBI:759187) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| risvodetinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ikt-148009 | ChEMBL |
| IKT148009 | ChEMBL |