EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759181 - palazestrant
| Formula | C28H36FN3O |
| Net Charge | 0 |
| Average Mass | 449.614 |
| Monoisotopic Mass | 449.28424 |
| SMILES | CCCN1CC(Oc2ccc([C@@H]3c4nc5ccccc5c4C[C@@H](C)N3CC(C)(C)F)cc2)C1 |
| InChI | InChI=1S/C28H36FN3O/c1-5-14-31-16-22(17-31)33-21-12-10-20(11-13-21)27-26-24(23-8-6-7-9-25(23)30-26)15-19(2)32(27)18-28(3,4)29/h6-13,19,22,27,30H,5,14-18H2,1-4H3/t19-,27-/m1/s1 |
| InChIKey | LBSFUBLFDCAEKV-XHCCPWGMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palazestrant (CHEBI:759181) has role antineoplastic agent (CHEBI:35610) |
| palazestrant (CHEBI:759181) is a harmala alkaloid (CHEBI:61379) |
| INN | Source |
|---|---|
| palazestrant | WHO MedNet |
| Synonym | Source |
|---|---|
| OP-1250 | ChEMBL |